C17H16FN3O4S2 — CID 11560572
N-(diaminomethylidene)-4-(4-fluorophenyl)-1-benzothiophene-2-carboxamide;methanesulfonic acid (PubChem CID 11560572) has the molecular formula C17H16FN3O4S2 and a molecular weight of 409.46 g/mol. Its IUPAC name is N-(diaminomethylidene)-4-(4-fluorophenyl)-1-benzothiophene-2-carboxamide;methanesulfonic acid.
| Compound Name | N-(diaminomethylidene)-4-(4-fluorophenyl)-1-benzothiophene-2-carboxamide;methanesulfonic acid |
|---|---|
| PubChem CID | 11560572 |
| Molecular Formula | C17H16FN3O4S2 |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | N-(diaminomethylidene)-4-(4-fluorophenyl)-1-benzothiophene-2-carboxamide;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.NC(N)=NC(=O)c1cc2c(-c3ccc(F)cc3)cccc2s1 |
| InChI | InChI=1S/C16H12FN3OS.CH4O3S/c17-10-6-4-9(5-7-10)11-2-1-3-13-12(11)8-14(22-13)15(21)20-16(18)19;1-5(2,3)4/h1-8H,(H4,18,19,20,21);1H3,(H,2,3,4) |
| InChIKey | UXWQXYLLWJRAGL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 135.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|