C18H14N6O2S2 — CID 11560588
4,10-bis(benzenesulfinyl)-1,5,6,7,11,12-hexazatricyclo[7.3.0.03,7]dodeca-3,5,9,11-tetraene (PubChem CID 11560588) has the molecular formula C18H14N6O2S2 and a molecular weight of 410.48 g/mol. Its IUPAC name is 4,10-bis(benzenesulfinyl)-1,5,6,7,11,12-hexazatricyclo[7.3.0.03,7]dodeca-3,5,9,11-tetraene.
| Compound Name | 4,10-bis(benzenesulfinyl)-1,5,6,7,11,12-hexazatricyclo[7.3.0.03,7]dodeca-3,5,9,11-tetraene |
|---|---|
| PubChem CID | 11560588 |
| Molecular Formula | C18H14N6O2S2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 4,10-bis(benzenesulfinyl)-1,5,6,7,11,12-hexazatricyclo[7.3.0.03,7]dodeca-3,5,9,11-tetraene |
| SMILES | O=S(c1ccccc1)c1nnn2c1Cn1nnc(S(=O)c3ccccc3)c1C2 |
| InChI | InChI=1S/C18H14N6O2S2/c25-27(13-7-3-1-4-8-13)17-15-11-24-16(12-23(15)21-19-17)18(20-22-24)28(26)14-9-5-2-6-10-14/h1-10H,11-12H2 |
| InChIKey | DSEDTYVPSIPXHW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 95.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |