C22H34O7 — CID 11560591
[(1R,2R,4S,5S,9R,10S,12S,13R,14S,16R)-2,12,16-trihydroxy-14-(hydroxymethyl)-5,9-dimethyl-15-oxo-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methyl acetate (PubChem CID 11560591) has the molecular formula C22H34O7 and a molecular weight of 410.51 g/mol. Its IUPAC name is [(1R,2R,4S,5S,9R,10S,12S,13R,14S,16R)-2,12,16-trihydroxy-14-(hydroxymethyl)-5,9-dimethyl-15-oxo-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methyl acetate.
| Compound Name | [(1R,2R,4S,5S,9R,10S,12S,13R,14S,16R)-2,12,16-trihydroxy-14-(hydroxymethyl)-5,9-dimethyl-15-oxo-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methyl acetate |
|---|---|
| PubChem CID | 11560591 |
| Molecular Formula | C22H34O7 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | [(1R,2R,4S,5S,9R,10S,12S,13R,14S,16R)-2,12,16-trihydroxy-14-(hydroxymethyl)-5,9-dimethyl-15-oxo-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methyl acetate |
| SMILES | CC(=O)OC[C@@]1(C)CCC[C@]2(C)[C@@H]1C[C@@H](O)[C@@]13C(=O)[C@H](CO)[C@@H]([C@H]1O)[C@@H](O)C[C@@H]23 |
| InChI | InChI=1S/C22H34O7/c1-11(24)29-10-20(2)5-4-6-21(3)14(20)8-16(26)22-15(21)7-13(25)17(19(22)28)12(9-23)18(22)27/h12-17,19,23,25-26,28H,4-10H2,1-3H3/t12-,13+,14-,15+,16-,17-,19-,20-,21-,22+/m1/s1 |
| InChIKey | ORSUIUGZTSBDDK-LDNCEZQRSA-N |
| XLogP | 0.66 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |