C14H14BrNO — CID 115606170
(5-bromo-2-pyridinyl)-(2,5-dimethylphenyl)methanol (PubChem CID 115606170) has the molecular formula C14H14BrNO and a molecular weight of 292.18 g/mol. Its IUPAC name is (5-bromo-2-pyridinyl)-(2,5-dimethylphenyl)methanol.
| Compound Name | (5-bromo-2-pyridinyl)-(2,5-dimethylphenyl)methanol |
|---|---|
| PubChem CID | 115606170 |
| Molecular Formula | C14H14BrNO |
| Molecular Weight | 292.18 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | (5-bromo-2-pyridinyl)-(2,5-dimethylphenyl)methanol |
| SMILES | Cc1ccc(C)c(C(O)c2ccc(Br)cn2)c1 |
| InChI | InChI=1S/C14H14BrNO/c1-9-3-4-10(2)12(7-9)14(17)13-6-5-11(15)8-16-13/h3-8,14,17H,1-2H3 |
| InChIKey | SHQNYKHRISPRER-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.18 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |