About 1-[6-(1,3-benzodioxol-5-yl)-4-(3-fluoro-2-pyridinyl)-1H-benzimidazol-2-yl]-3-ethylurea
1-[6-(1,3-benzodioxol-5-yl)-4-(3-fluoro-2-pyridinyl)-1H-benzimidazol-2-yl]-3-ethylurea (PubChem CID 11560781) has the molecular formula C22H18FN5O3
and a molecular weight of 419.42 g/mol. Its IUPAC name is 1-[6-(1,3-benzodioxol-5-yl)-4-(3-fluoro-2-pyridinyl)-1H-benzimidazol-2-yl]-3-ethylurea.
Molecular Properties
| Compound Name | 1-[6-(1,3-benzodioxol-5-yl)-4-(3-fluoro-2-pyridinyl)-1H-benzimidazol-2-yl]-3-ethylurea |
| PubChem CID | 11560781 |
| Molecular Formula | C22H18FN5O3 |
| Molecular Weight | 419.42 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 1-[6-(1,3-benzodioxol-5-yl)-4-(3-fluoro-2-pyridinyl)-1H-benzimidazol-2-yl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1nc2c(-c3ncccc3F)cc(-c3ccc4c(c3)OCO4)cc2[nH]1 |
| InChI | InChI=1S/C22H18FN5O3/c1-2-24-22(29)28-21-26-16-9-13(12-5-6-17-18(10-12)31-11-30-17)8-14(20(16)27-21)19-15(23)4-3-7-25-19/h3-10H,2,11H2,1H3,(H3,24,26,27,28,29) |
| InChIKey | ULGIVLCAFYCCNC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 101.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[6-(1,3-benzodioxol-5-yl)-4-(3-fluoro-2-pyridinyl)-1H-benzimidazol-2-yl]-3-ethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-(1,3-benzodioxol-5-yl)-4-(3-fluoro-2-pyridinyl)-1H-benzimidazol-2-yl]-3-ethylurea?
The IUPAC name of 1-[6-(1,3-benzodioxol-5-yl)-4-(3-fluoro-2-pyridinyl)-1H-benzimidazol-2-yl]-3-ethylurea (CID 11560781) is 1-[6-(1,3-benzodioxol-5-yl)-4-(3-fluoro-2-pyridinyl)-1H-benzimidazol-2-yl]-3-ethylurea.
What is the SMILES notation for 1-[6-(1,3-benzodioxol-5-yl)-4-(3-fluoro-2-pyridinyl)-1H-benzimidazol-2-yl]-3-ethylurea?
The canonical SMILES for 1-[6-(1,3-benzodioxol-5-yl)-4-(3-fluoro-2-pyridinyl)-1H-benzimidazol-2-yl]-3-ethylurea is CCNC(=O)Nc1nc2c(-c3ncccc3F)cc(-c3ccc4c(c3)OCO4)cc2[nH]1.
What is the InChIKey of 1-[6-(1,3-benzodioxol-5-yl)-4-(3-fluoro-2-pyridinyl)-1H-benzimidazol-2-yl]-3-ethylurea?
The InChIKey is ULGIVLCAFYCCNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18FN5O3/c1-2-24-22(29)28-21-26-16-9-13(12-5-6-17-18(10-12)31-11-30-17)8-14(20(16)27-21)19-15(23)4-3-7-25-19/h3-10H,2,11H2,1H3,(H3,24,26,27,28,29).
What are the key properties of 1-[6-(1,3-benzodioxol-5-yl)-4-(3-fluoro-2-pyridinyl)-1H-benzimidazol-2-yl]-3-ethylurea?
1-[6-(1,3-benzodioxol-5-yl)-4-(3-fluoro-2-pyridinyl)-1H-benzimidazol-2-yl]-3-ethylurea has a molecular weight of 419.42 g/mol, XLogP of 4.30, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(1,3-benzodioxol-5-yl)-4-(3-fluoro-2-pyridinyl)-1H-benzimidazol-2-yl]-3-ethylurea is sourced from PubChem (CID 11560781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).