About N,N-dimethyl-5-[[(1-methylpyrazol-4-yl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride
N,N-dimethyl-5-[[(1-methylpyrazol-4-yl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride (PubChem CID 115607960) has the molecular formula C10H16ClN5S
and a molecular weight of 273.79 g/mol. Its IUPAC name is N,N-dimethyl-5-[[(1-methylpyrazol-4-yl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride.
Molecular Properties
| Compound Name | N,N-dimethyl-5-[[(1-methylpyrazol-4-yl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride |
| PubChem CID | 115607960 |
| Molecular Formula | C10H16ClN5S |
| Molecular Weight | 273.79 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | N,N-dimethyl-5-[[(1-methylpyrazol-4-yl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride |
| SMILES | CN(C)c1ncc(CNc2cnn(C)c2)s1.Cl |
| InChI | InChI=1S/C10H15N5S.ClH/c1-14(2)10-12-6-9(16-10)5-11-8-4-13-15(3)7-8;/h4,6-7,11H,5H2,1-3H3;1H |
| InChIKey | OUXFNSILNQCJNI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.79 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N,N-dimethyl-5-[[(1-methylpyrazol-4-yl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-5-[[(1-methylpyrazol-4-yl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride?
The IUPAC name of N,N-dimethyl-5-[[(1-methylpyrazol-4-yl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride (CID 115607960) is N,N-dimethyl-5-[[(1-methylpyrazol-4-yl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride.
What is the SMILES notation for N,N-dimethyl-5-[[(1-methylpyrazol-4-yl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride?
The canonical SMILES for N,N-dimethyl-5-[[(1-methylpyrazol-4-yl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride is CN(C)c1ncc(CNc2cnn(C)c2)s1.Cl.
What is the InChIKey of N,N-dimethyl-5-[[(1-methylpyrazol-4-yl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride?
The InChIKey is OUXFNSILNQCJNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N5S.ClH/c1-14(2)10-12-6-9(16-10)5-11-8-4-13-15(3)7-8;/h4,6-7,11H,5H2,1-3H3;1H.
What are the key properties of N,N-dimethyl-5-[[(1-methylpyrazol-4-yl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride?
N,N-dimethyl-5-[[(1-methylpyrazol-4-yl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride has a molecular weight of 273.79 g/mol, XLogP of 1.98, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-5-[[(1-methylpyrazol-4-yl)amino]methyl]-1,3-thiazol-2-amine;hydrochloride is sourced from PubChem (CID 115607960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).