C19H14F6O4 — CID 11560797
2,2-dimethoxy-1,3-bis[4-(trifluoromethyl)phenyl]propane-1,3-dione (PubChem CID 11560797) has the molecular formula C19H14F6O4 and a molecular weight of 420.31 g/mol. Its IUPAC name is 2,2-dimethoxy-1,3-bis[4-(trifluoromethyl)phenyl]propane-1,3-dione.
| Compound Name | 2,2-dimethoxy-1,3-bis[4-(trifluoromethyl)phenyl]propane-1,3-dione |
|---|---|
| PubChem CID | 11560797 |
| Molecular Formula | C19H14F6O4 |
| Molecular Weight | 420.31 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 2,2-dimethoxy-1,3-bis[4-(trifluoromethyl)phenyl]propane-1,3-dione |
| SMILES | COC(OC)(C(=O)c1ccc(C(F)(F)F)cc1)C(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H14F6O4/c1-28-17(29-2,15(26)11-3-7-13(8-4-11)18(20,21)22)16(27)12-5-9-14(10-6-12)19(23,24)25/h3-10H,1-2H3 |
| InChIKey | CFJJIJRAZUUGAR-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.31 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|