C10H12BrN3OS — CID 115607977
2-[4-[(5-bromothiophen-2-yl)methylamino]pyrazol-1-yl]ethanol (PubChem CID 115607977) has the molecular formula C10H12BrN3OS and a molecular weight of 302.20 g/mol. Its IUPAC name is 2-[4-[(5-bromothiophen-2-yl)methylamino]pyrazol-1-yl]ethanol.
| Compound Name | 2-[4-[(5-bromothiophen-2-yl)methylamino]pyrazol-1-yl]ethanol |
|---|---|
| PubChem CID | 115607977 |
| Molecular Formula | C10H12BrN3OS |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | 2-[4-[(5-bromothiophen-2-yl)methylamino]pyrazol-1-yl]ethanol |
| SMILES | OCCn1cc(NCc2ccc(Br)s2)cn1 |
| InChI | InChI=1S/C10H12BrN3OS/c11-10-2-1-9(16-10)6-12-8-5-13-14(7-8)3-4-15/h1-2,5,7,12,15H,3-4,6H2 |
| InChIKey | LFVXXTABLUADAU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |