C13H12ClN3O3 — CID 115608605
N-(6-chloropyridazin-3-yl)-2,5-dimethoxybenzamide (PubChem CID 115608605) has the molecular formula C13H12ClN3O3 and a molecular weight of 293.71 g/mol. Its IUPAC name is N-(6-chloropyridazin-3-yl)-2,5-dimethoxybenzamide.
| Compound Name | N-(6-chloropyridazin-3-yl)-2,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 115608605 |
| Molecular Formula | C13H12ClN3O3 |
| Molecular Weight | 293.71 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | N-(6-chloropyridazin-3-yl)-2,5-dimethoxybenzamide |
| SMILES | COc1ccc(OC)c(C(=O)Nc2ccc(Cl)nn2)c1 |
| InChI | InChI=1S/C13H12ClN3O3/c1-19-8-3-4-10(20-2)9(7-8)13(18)15-12-6-5-11(14)16-17-12/h3-7H,1-2H3,(H,15,17,18) |
| InChIKey | NWQNGOMPMLCDCP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.71 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |