About 3-hydroxy-N-(2,2,2-trifluoroethyl)azetidine-1-carboxamide
3-hydroxy-N-(2,2,2-trifluoroethyl)azetidine-1-carboxamide (PubChem CID 115608964) has the molecular formula C6H9F3N2O2
and a molecular weight of 198.14 g/mol. Its IUPAC name is 3-hydroxy-N-(2,2,2-trifluoroethyl)azetidine-1-carboxamide.
Molecular Properties
| Compound Name | 3-hydroxy-N-(2,2,2-trifluoroethyl)azetidine-1-carboxamide |
| PubChem CID | 115608964 |
| Molecular Formula | C6H9F3N2O2 |
| Molecular Weight | 198.14 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | 3-hydroxy-N-(2,2,2-trifluoroethyl)azetidine-1-carboxamide |
| SMILES | O=C(NCC(F)(F)F)N1CC(O)C1 |
| InChI | InChI=1S/C6H9F3N2O2/c7-6(8,9)3-10-5(13)11-1-4(12)2-11/h4,12H,1-3H2,(H,10,13) |
| InChIKey | UKYSPIRRWJJAHX-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.14 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-hydroxy-N-(2,2,2-trifluoroethyl)azetidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-N-(2,2,2-trifluoroethyl)azetidine-1-carboxamide?
The IUPAC name of 3-hydroxy-N-(2,2,2-trifluoroethyl)azetidine-1-carboxamide (CID 115608964) is 3-hydroxy-N-(2,2,2-trifluoroethyl)azetidine-1-carboxamide.
What is the SMILES notation for 3-hydroxy-N-(2,2,2-trifluoroethyl)azetidine-1-carboxamide?
The canonical SMILES for 3-hydroxy-N-(2,2,2-trifluoroethyl)azetidine-1-carboxamide is O=C(NCC(F)(F)F)N1CC(O)C1.
What is the InChIKey of 3-hydroxy-N-(2,2,2-trifluoroethyl)azetidine-1-carboxamide?
The InChIKey is UKYSPIRRWJJAHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9F3N2O2/c7-6(8,9)3-10-5(13)11-1-4(12)2-11/h4,12H,1-3H2,(H,10,13).
What are the key properties of 3-hydroxy-N-(2,2,2-trifluoroethyl)azetidine-1-carboxamide?
3-hydroxy-N-(2,2,2-trifluoroethyl)azetidine-1-carboxamide has a molecular weight of 198.14 g/mol, XLogP of -0.07, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-N-(2,2,2-trifluoroethyl)azetidine-1-carboxamide is sourced from PubChem (CID 115608964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).