C15H19N3O2 — CID 115610134
N-(4,5-dimethyl-1H-pyrazol-3-yl)-3-(3-methylphenoxy)propanamide (PubChem CID 115610134) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is N-(4,5-dimethyl-1H-pyrazol-3-yl)-3-(3-methylphenoxy)propanamide.
| Compound Name | N-(4,5-dimethyl-1H-pyrazol-3-yl)-3-(3-methylphenoxy)propanamide |
|---|---|
| PubChem CID | 115610134 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | N-(4,5-dimethyl-1H-pyrazol-3-yl)-3-(3-methylphenoxy)propanamide |
| SMILES | Cc1cccc(OCCC(=O)Nc2n[nH]c(C)c2C)c1 |
| InChI | InChI=1S/C15H19N3O2/c1-10-5-4-6-13(9-10)20-8-7-14(19)16-15-11(2)12(3)17-18-15/h4-6,9H,7-8H2,1-3H3,(H2,16,17,18,19) |
| InChIKey | LGVINKRLYXIPLJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |