C26H25NO3S — CID 11561051
ethyl 2-[[(Z)-3-oxo-1,3-diphenylprop-1-enyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 11561051) has the molecular formula C26H25NO3S and a molecular weight of 431.56 g/mol. Its IUPAC name is ethyl 2-[[(Z)-3-oxo-1,3-diphenylprop-1-enyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(Z)-3-oxo-1,3-diphenylprop-1-enyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 11561051 |
| Molecular Formula | C26H25NO3S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | ethyl 2-[[(Z)-3-oxo-1,3-diphenylprop-1-enyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(N/C(=C\C(=O)c2ccccc2)c2ccccc2)sc2c1CCCC2 |
| InChI | InChI=1S/C26H25NO3S/c1-2-30-26(29)24-20-15-9-10-16-23(20)31-25(24)27-21(18-11-5-3-6-12-18)17-22(28)19-13-7-4-8-14-19/h3-8,11-14,17,27H,2,9-10,15-16H2,1H3/b21-17- |
| InChIKey | JZAUOCKLXHYXCJ-FXBPSFAMSA-N |
| XLogP | 6.14 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|