C13H26ClN3 — CID 115610520
2,2-dimethyl-N-[4-(1-methylpyrazol-4-yl)butyl]propan-1-amine;hydrochloride (PubChem CID 115610520) has the molecular formula C13H26ClN3 and a molecular weight of 259.82 g/mol. Its IUPAC name is 2,2-dimethyl-N-[4-(1-methylpyrazol-4-yl)butyl]propan-1-amine;hydrochloride.
| Compound Name | 2,2-dimethyl-N-[4-(1-methylpyrazol-4-yl)butyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 115610520 |
| Molecular Formula | C13H26ClN3 |
| Molecular Weight | 259.82 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 2,2-dimethyl-N-[4-(1-methylpyrazol-4-yl)butyl]propan-1-amine;hydrochloride |
| SMILES | Cl.Cn1cc(CCCCNCC(C)(C)C)cn1 |
| InChI | InChI=1S/C13H25N3.ClH/c1-13(2,3)11-14-8-6-5-7-12-9-15-16(4)10-12;/h9-10,14H,5-8,11H2,1-4H3;1H |
| InChIKey | DLJFJAUMHQMVHH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.82 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|