C9H14ClN3O2S2 — CID 115611984
4-(5-chloro-1-methylimidazol-4-yl)sulfonyl-2-methylthiomorpholine (PubChem CID 115611984) has the molecular formula C9H14ClN3O2S2 and a molecular weight of 295.82 g/mol. Its IUPAC name is 4-(5-chloro-1-methylimidazol-4-yl)sulfonyl-2-methylthiomorpholine.
| Compound Name | 4-(5-chloro-1-methylimidazol-4-yl)sulfonyl-2-methylthiomorpholine |
|---|---|
| PubChem CID | 115611984 |
| Molecular Formula | C9H14ClN3O2S2 |
| Molecular Weight | 295.82 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 4-(5-chloro-1-methylimidazol-4-yl)sulfonyl-2-methylthiomorpholine |
| SMILES | CC1CN(S(=O)(=O)c2ncn(C)c2Cl)CCS1 |
| InChI | InChI=1S/C9H14ClN3O2S2/c1-7-5-13(3-4-16-7)17(14,15)9-8(10)12(2)6-11-9/h6-7H,3-5H2,1-2H3 |
| InChIKey | NGYRXCWFAVYFAO-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.82 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |