C12H14F2N2O2 — CID 115612021
3-(4-acetylphenyl)-1-(2,2-difluoroethyl)-1-methylurea (PubChem CID 115612021) has the molecular formula C12H14F2N2O2 and a molecular weight of 256.25 g/mol. Its IUPAC name is 3-(4-acetylphenyl)-1-(2,2-difluoroethyl)-1-methylurea.
| Compound Name | 3-(4-acetylphenyl)-1-(2,2-difluoroethyl)-1-methylurea |
|---|---|
| PubChem CID | 115612021 |
| Molecular Formula | C12H14F2N2O2 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 3-(4-acetylphenyl)-1-(2,2-difluoroethyl)-1-methylurea |
| SMILES | CC(=O)c1ccc(NC(=O)N(C)CC(F)F)cc1 |
| InChI | InChI=1S/C12H14F2N2O2/c1-8(17)9-3-5-10(6-4-9)15-12(18)16(2)7-11(13)14/h3-6,11H,7H2,1-2H3,(H,15,18) |
| InChIKey | YMHYBWOOYNSGGW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |