About 1-(2,2-difluoroethyl)-1,3-dimethylurea
1-(2,2-difluoroethyl)-1,3-dimethylurea (PubChem CID 115612114) has the molecular formula C5H10F2N2O
and a molecular weight of 152.14 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-1,3-dimethylurea.
Molecular Properties
| Compound Name | 1-(2,2-difluoroethyl)-1,3-dimethylurea |
| PubChem CID | 115612114 |
| Molecular Formula | C5H10F2N2O |
| Molecular Weight | 152.14 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 1-(2,2-difluoroethyl)-1,3-dimethylurea |
| SMILES | CNC(=O)N(C)CC(F)F |
| InChI | InChI=1S/C5H10F2N2O/c1-8-5(10)9(2)3-4(6)7/h4H,3H2,1-2H3,(H,8,10) |
| InChIKey | VVGJXJPGGRRBBF-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.14 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2,2-difluoroethyl)-1,3-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-difluoroethyl)-1,3-dimethylurea?
The IUPAC name of 1-(2,2-difluoroethyl)-1,3-dimethylurea (CID 115612114) is 1-(2,2-difluoroethyl)-1,3-dimethylurea.
What is the SMILES notation for 1-(2,2-difluoroethyl)-1,3-dimethylurea?
The canonical SMILES for 1-(2,2-difluoroethyl)-1,3-dimethylurea is CNC(=O)N(C)CC(F)F.
What is the InChIKey of 1-(2,2-difluoroethyl)-1,3-dimethylurea?
The InChIKey is VVGJXJPGGRRBBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10F2N2O/c1-8-5(10)9(2)3-4(6)7/h4H,3H2,1-2H3,(H,8,10).
What are the key properties of 1-(2,2-difluoroethyl)-1,3-dimethylurea?
1-(2,2-difluoroethyl)-1,3-dimethylurea has a molecular weight of 152.14 g/mol, XLogP of 0.52, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-difluoroethyl)-1,3-dimethylurea is sourced from PubChem (CID 115612114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).