About 4-[(4,5-dihydro-1H-imidazol-2-ylamino)methyl]oxan-4-ol
4-[(4,5-dihydro-1H-imidazol-2-ylamino)methyl]oxan-4-ol (PubChem CID 115612131) has the molecular formula C9H17N3O2
and a molecular weight of 199.25 g/mol. Its IUPAC name is 4-[(4,5-dihydro-1H-imidazol-2-ylamino)methyl]oxan-4-ol.
Molecular Properties
| Compound Name | 4-[(4,5-dihydro-1H-imidazol-2-ylamino)methyl]oxan-4-ol |
| PubChem CID | 115612131 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 4-[(4,5-dihydro-1H-imidazol-2-ylamino)methyl]oxan-4-ol |
| SMILES | OC1(CNC2=NCCN2)CCOCC1 |
| InChI | InChI=1S/C9H17N3O2/c13-9(1-5-14-6-2-9)7-12-8-10-3-4-11-8/h13H,1-7H2,(H2,10,11,12) |
| InChIKey | NQDMEVVAWXAUPW-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(4,5-dihydro-1H-imidazol-2-ylamino)methyl]oxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4,5-dihydro-1H-imidazol-2-ylamino)methyl]oxan-4-ol?
The IUPAC name of 4-[(4,5-dihydro-1H-imidazol-2-ylamino)methyl]oxan-4-ol (CID 115612131) is 4-[(4,5-dihydro-1H-imidazol-2-ylamino)methyl]oxan-4-ol.
What is the SMILES notation for 4-[(4,5-dihydro-1H-imidazol-2-ylamino)methyl]oxan-4-ol?
The canonical SMILES for 4-[(4,5-dihydro-1H-imidazol-2-ylamino)methyl]oxan-4-ol is OC1(CNC2=NCCN2)CCOCC1.
What is the InChIKey of 4-[(4,5-dihydro-1H-imidazol-2-ylamino)methyl]oxan-4-ol?
The InChIKey is NQDMEVVAWXAUPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O2/c13-9(1-5-14-6-2-9)7-12-8-10-3-4-11-8/h13H,1-7H2,(H2,10,11,12).
What are the key properties of 4-[(4,5-dihydro-1H-imidazol-2-ylamino)methyl]oxan-4-ol?
4-[(4,5-dihydro-1H-imidazol-2-ylamino)methyl]oxan-4-ol has a molecular weight of 199.25 g/mol, XLogP of -0.92, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4,5-dihydro-1H-imidazol-2-ylamino)methyl]oxan-4-ol is sourced from PubChem (CID 115612131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).