C20H29NO8S — CID 11561319
[(2S,3R,6R,8R)-6,8-dihydroxy-2-methyl-1-oxo-1-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]nonan-3-yl] methanesulfonate (PubChem CID 11561319) has the molecular formula C20H29NO8S and a molecular weight of 443.52 g/mol. Its IUPAC name is [(2S,3R,6R,8R)-6,8-dihydroxy-2-methyl-1-oxo-1-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]nonan-3-yl] methanesulfonate.
| Compound Name | [(2S,3R,6R,8R)-6,8-dihydroxy-2-methyl-1-oxo-1-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]nonan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 11561319 |
| Molecular Formula | C20H29NO8S |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | [(2S,3R,6R,8R)-6,8-dihydroxy-2-methyl-1-oxo-1-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]nonan-3-yl] methanesulfonate |
| SMILES | C[C@H](C(=O)N1C(=O)OC[C@@H]1c1ccccc1)[C@@H](CC[C@@H](O)C[C@@H](C)O)OS(C)(=O)=O |
| InChI | InChI=1S/C20H29NO8S/c1-13(22)11-16(23)9-10-18(29-30(3,26)27)14(2)19(24)21-17(12-28-20(21)25)15-7-5-4-6-8-15/h4-8,13-14,16-18,22-23H,9-12H2,1-3H3/t13-,14+,16-,17-,18-/m1/s1 |
| InChIKey | JTISEKQCIYZFEP-WTNVTLLGSA-N |
| XLogP | 1.60 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|