About 2-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methylamino]-N,N-diethylacetamide
2-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methylamino]-N,N-diethylacetamide (PubChem CID 115614318) has the molecular formula C17H26N2O2
and a molecular weight of 290.41 g/mol. Its IUPAC name is 2-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methylamino]-N,N-diethylacetamide.
Molecular Properties
| Compound Name | 2-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methylamino]-N,N-diethylacetamide |
| PubChem CID | 115614318 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 2-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methylamino]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CNCc1ccc2c(c1)CC(C)(C)O2 |
| InChI | InChI=1S/C17H26N2O2/c1-5-19(6-2)16(20)12-18-11-13-7-8-15-14(9-13)10-17(3,4)21-15/h7-9,18H,5-6,10-12H2,1-4H3 |
| InChIKey | AKQYOEBAGVLYIS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methylamino]-N,N-diethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methylamino]-N,N-diethylacetamide?
The IUPAC name of 2-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methylamino]-N,N-diethylacetamide (CID 115614318) is 2-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methylamino]-N,N-diethylacetamide.
What is the SMILES notation for 2-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methylamino]-N,N-diethylacetamide?
The canonical SMILES for 2-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methylamino]-N,N-diethylacetamide is CCN(CC)C(=O)CNCc1ccc2c(c1)CC(C)(C)O2.
What is the InChIKey of 2-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methylamino]-N,N-diethylacetamide?
The InChIKey is AKQYOEBAGVLYIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O2/c1-5-19(6-2)16(20)12-18-11-13-7-8-15-14(9-13)10-17(3,4)21-15/h7-9,18H,5-6,10-12H2,1-4H3.
What are the key properties of 2-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methylamino]-N,N-diethylacetamide?
2-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methylamino]-N,N-diethylacetamide has a molecular weight of 290.41 g/mol, XLogP of 2.36, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methylamino]-N,N-diethylacetamide is sourced from PubChem (CID 115614318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).