C18H24N2S — CID 115615379
1,3-dimethyl-N-[(4-phenylthiophen-2-yl)methyl]piperidin-4-amine (PubChem CID 115615379) has the molecular formula C18H24N2S and a molecular weight of 300.47 g/mol. Its IUPAC name is 1,3-dimethyl-N-[(4-phenylthiophen-2-yl)methyl]piperidin-4-amine.
| Compound Name | 1,3-dimethyl-N-[(4-phenylthiophen-2-yl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 115615379 |
| Molecular Formula | C18H24N2S |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 1,3-dimethyl-N-[(4-phenylthiophen-2-yl)methyl]piperidin-4-amine |
| SMILES | CC1CN(C)CCC1NCc1cc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C18H24N2S/c1-14-12-20(2)9-8-18(14)19-11-17-10-16(13-21-17)15-6-4-3-5-7-15/h3-7,10,13-14,18-19H,8-9,11-12H2,1-2H3 |
| InChIKey | YQUKYRPQVBFZSW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |