C12H26ClNS — CID 115616057
N-(2,2-dimethylpentan-3-yl)thian-4-amine;hydrochloride (PubChem CID 115616057) has the molecular formula C12H26ClNS and a molecular weight of 251.87 g/mol. Its IUPAC name is N-(2,2-dimethylpentan-3-yl)thian-4-amine;hydrochloride.
| Compound Name | N-(2,2-dimethylpentan-3-yl)thian-4-amine;hydrochloride |
|---|---|
| PubChem CID | 115616057 |
| Molecular Formula | C12H26ClNS |
| Molecular Weight | 251.87 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | N-(2,2-dimethylpentan-3-yl)thian-4-amine;hydrochloride |
| SMILES | CCC(NC1CCSCC1)C(C)(C)C.Cl |
| InChI | InChI=1S/C12H25NS.ClH/c1-5-11(12(2,3)4)13-10-6-8-14-9-7-10;/h10-11,13H,5-9H2,1-4H3;1H |
| InChIKey | BVGNNZSPGFFCIT-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.87 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |