About 1-(oxan-3-yl)-3-(2,2,2-trifluoroethyl)urea
1-(oxan-3-yl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 115616412) has the molecular formula C8H13F3N2O2
and a molecular weight of 226.20 g/mol. Its IUPAC name is 1-(oxan-3-yl)-3-(2,2,2-trifluoroethyl)urea.
Molecular Properties
| Compound Name | 1-(oxan-3-yl)-3-(2,2,2-trifluoroethyl)urea |
| PubChem CID | 115616412 |
| Molecular Formula | C8H13F3N2O2 |
| Molecular Weight | 226.20 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 1-(oxan-3-yl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCC(F)(F)F)NC1CCCOC1 |
| InChI | InChI=1S/C8H13F3N2O2/c9-8(10,11)5-12-7(14)13-6-2-1-3-15-4-6/h6H,1-5H2,(H2,12,13,14) |
| InChIKey | GYWNKGXVCPBZBJ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.20 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(oxan-3-yl)-3-(2,2,2-trifluoroethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(oxan-3-yl)-3-(2,2,2-trifluoroethyl)urea?
The IUPAC name of 1-(oxan-3-yl)-3-(2,2,2-trifluoroethyl)urea (CID 115616412) is 1-(oxan-3-yl)-3-(2,2,2-trifluoroethyl)urea.
What is the SMILES notation for 1-(oxan-3-yl)-3-(2,2,2-trifluoroethyl)urea?
The canonical SMILES for 1-(oxan-3-yl)-3-(2,2,2-trifluoroethyl)urea is O=C(NCC(F)(F)F)NC1CCCOC1.
What is the InChIKey of 1-(oxan-3-yl)-3-(2,2,2-trifluoroethyl)urea?
The InChIKey is GYWNKGXVCPBZBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F3N2O2/c9-8(10,11)5-12-7(14)13-6-2-1-3-15-4-6/h6H,1-5H2,(H2,12,13,14).
What are the key properties of 1-(oxan-3-yl)-3-(2,2,2-trifluoroethyl)urea?
1-(oxan-3-yl)-3-(2,2,2-trifluoroethyl)urea has a molecular weight of 226.20 g/mol, XLogP of 1.03, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(oxan-3-yl)-3-(2,2,2-trifluoroethyl)urea is sourced from PubChem (CID 115616412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).