6-bromo-2-ethoxy-3,4-dihydro-1H-naphthalene-2-carboxylic acid

C13H15BrO3 — CID 115616483

IUPAC6-bromo-2-ethoxy-3,4-dihydro-1H-naphthalene-2-carboxylic acid
SMILESCCOC1(C(=O)O)CCc2cc(Br)ccc2C1
InChIInChI=1S/C13H15BrO3/c1-2-17-13(12(15)16)6-5-9-7-11(14)4-3-10(9)8-13/h3-4,7H,2,5-6,8H2,1H3,(H,15,16)
InChIKeyMXSILIQGIYSKGV-UHFFFAOYSA-N
MW299.16 g/mol
LogP2.80
Rot. Bonds3

About 6-bromo-2-ethoxy-3,4-dihydro-1H-naphthalene-2-carboxylic acid

6-bromo-2-ethoxy-3,4-dihydro-1H-naphthalene-2-carboxylic acid (PubChem CID 115616483) has the molecular formula C13H15BrO3 and a molecular weight of 299.16 g/mol. Its IUPAC name is 6-bromo-2-ethoxy-3,4-dihydro-1H-naphthalene-2-carboxylic acid.

Molecular Properties

Compound Name6-bromo-2-ethoxy-3,4-dihydro-1H-naphthalene-2-carboxylic acid
PubChem CID115616483
Molecular FormulaC13H15BrO3
Molecular Weight299.16 g/mol
Exact Mass298.02
IUPAC Name6-bromo-2-ethoxy-3,4-dihydro-1H-naphthalene-2-carboxylic acid
SMILESCCOC1(C(=O)O)CCc2cc(Br)ccc2C1
InChIInChI=1S/C13H15BrO3/c1-2-17-13(12(15)16)6-5-9-7-11(14)4-3-10(9)8-13/h3-4,7H,2,5-6,8H2,1H3,(H,15,16)
InChIKeyMXSILIQGIYSKGV-UHFFFAOYSA-N
XLogP2.80
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500299.16
LogP ≤ 52.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 6-bromo-2-ethoxy-3,4-dihydro-1H-naphthalene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-bromo-2-ethoxy-3,4-dihydro-1H-naphthalene-2-carboxylic acid?
The IUPAC name of 6-bromo-2-ethoxy-3,4-dihydro-1H-naphthalene-2-carboxylic acid (CID 115616483) is 6-bromo-2-ethoxy-3,4-dihydro-1H-naphthalene-2-carboxylic acid.
What is the SMILES notation for 6-bromo-2-ethoxy-3,4-dihydro-1H-naphthalene-2-carboxylic acid?
The canonical SMILES for 6-bromo-2-ethoxy-3,4-dihydro-1H-naphthalene-2-carboxylic acid is CCOC1(C(=O)O)CCc2cc(Br)ccc2C1.
What is the InChIKey of 6-bromo-2-ethoxy-3,4-dihydro-1H-naphthalene-2-carboxylic acid?
The InChIKey is MXSILIQGIYSKGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15BrO3/c1-2-17-13(12(15)16)6-5-9-7-11(14)4-3-10(9)8-13/h3-4,7H,2,5-6,8H2,1H3,(H,15,16).
What are the key properties of 6-bromo-2-ethoxy-3,4-dihydro-1H-naphthalene-2-carboxylic acid?
6-bromo-2-ethoxy-3,4-dihydro-1H-naphthalene-2-carboxylic acid has a molecular weight of 299.16 g/mol, XLogP of 2.80, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-ethoxy-3,4-dihydro-1H-naphthalene-2-carboxylic acid is sourced from PubChem (CID 115616483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).