C17H25N3O — CID 115617829
1-(1-benzylpiperidin-3-yl)-3-cyclobutylurea (PubChem CID 115617829) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-3-yl)-3-cyclobutylurea.
| Compound Name | 1-(1-benzylpiperidin-3-yl)-3-cyclobutylurea |
|---|---|
| PubChem CID | 115617829 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 1-(1-benzylpiperidin-3-yl)-3-cyclobutylurea |
| SMILES | O=C(NC1CCC1)NC1CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C17H25N3O/c21-17(18-15-8-4-9-15)19-16-10-5-11-20(13-16)12-14-6-2-1-3-7-14/h1-3,6-7,15-16H,4-5,8-13H2,(H2,18,19,21) |
| InChIKey | MNCJNNQEFLKYCN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |