C11H12Br2N2O — CID 115617878
1-cyclobutyl-3-(2,4-dibromophenyl)urea (PubChem CID 115617878) has the molecular formula C11H12Br2N2O and a molecular weight of 348.04 g/mol. Its IUPAC name is 1-cyclobutyl-3-(2,4-dibromophenyl)urea.
| Compound Name | 1-cyclobutyl-3-(2,4-dibromophenyl)urea |
|---|---|
| PubChem CID | 115617878 |
| Molecular Formula | C11H12Br2N2O |
| Molecular Weight | 348.04 g/mol |
| Exact Mass | 345.93 |
| IUPAC Name | 1-cyclobutyl-3-(2,4-dibromophenyl)urea |
| SMILES | O=C(Nc1ccc(Br)cc1Br)NC1CCC1 |
| InChI | InChI=1S/C11H12Br2N2O/c12-7-4-5-10(9(13)6-7)15-11(16)14-8-2-1-3-8/h4-6,8H,1-3H2,(H2,14,15,16) |
| InChIKey | DVGPTOKCVMVYAO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.04 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |