C14H18F2N2O2 — CID 115618229
3-[(2,3-difluorophenyl)methylamino]-1-morpholin-4-ylpropan-1-one (PubChem CID 115618229) has the molecular formula C14H18F2N2O2 and a molecular weight of 284.31 g/mol. Its IUPAC name is 3-[(2,3-difluorophenyl)methylamino]-1-morpholin-4-ylpropan-1-one.
| Compound Name | 3-[(2,3-difluorophenyl)methylamino]-1-morpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 115618229 |
| Molecular Formula | C14H18F2N2O2 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 3-[(2,3-difluorophenyl)methylamino]-1-morpholin-4-ylpropan-1-one |
| SMILES | O=C(CCNCc1cccc(F)c1F)N1CCOCC1 |
| InChI | InChI=1S/C14H18F2N2O2/c15-12-3-1-2-11(14(12)16)10-17-5-4-13(19)18-6-8-20-9-7-18/h1-3,17H,4-10H2 |
| InChIKey | XTSBSYXKAONRII-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|