C13H24ClN3 — CID 115618877
2-butyl-N-(1H-imidazol-2-ylmethyl)cyclopentan-1-amine;hydrochloride (PubChem CID 115618877) has the molecular formula C13H24ClN3 and a molecular weight of 257.81 g/mol. Its IUPAC name is 2-butyl-N-(1H-imidazol-2-ylmethyl)cyclopentan-1-amine;hydrochloride.
| Compound Name | 2-butyl-N-(1H-imidazol-2-ylmethyl)cyclopentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 115618877 |
| Molecular Formula | C13H24ClN3 |
| Molecular Weight | 257.81 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | 2-butyl-N-(1H-imidazol-2-ylmethyl)cyclopentan-1-amine;hydrochloride |
| SMILES | CCCCC1CCCC1NCc1ncc[nH]1.Cl |
| InChI | InChI=1S/C13H23N3.ClH/c1-2-3-5-11-6-4-7-12(11)16-10-13-14-8-9-15-13;/h8-9,11-12,16H,2-7,10H2,1H3,(H,14,15);1H |
| InChIKey | AOADJQXIIPWLSS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.81 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |