C12H15F3N2O2 — CID 115619743
1-(1-hydroxy-2-phenylpropan-2-yl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 115619743) has the molecular formula C12H15F3N2O2 and a molecular weight of 276.26 g/mol. Its IUPAC name is 1-(1-hydroxy-2-phenylpropan-2-yl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(1-hydroxy-2-phenylpropan-2-yl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 115619743 |
| Molecular Formula | C12H15F3N2O2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 1-(1-hydroxy-2-phenylpropan-2-yl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CC(CO)(NC(=O)NCC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C12H15F3N2O2/c1-11(8-18,9-5-3-2-4-6-9)17-10(19)16-7-12(13,14)15/h2-6,18H,7-8H2,1H3,(H2,16,17,19) |
| InChIKey | QFECVBGFDRPWTL-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |