C12H14FN3O3S — CID 115620973
N-(4-ethoxy-3-fluorophenyl)-5-methyl-1H-pyrazole-4-sulfonamide (PubChem CID 115620973) has the molecular formula C12H14FN3O3S and a molecular weight of 299.33 g/mol. Its IUPAC name is N-(4-ethoxy-3-fluorophenyl)-5-methyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(4-ethoxy-3-fluorophenyl)-5-methyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 115620973 |
| Molecular Formula | C12H14FN3O3S |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | N-(4-ethoxy-3-fluorophenyl)-5-methyl-1H-pyrazole-4-sulfonamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2cn[nH]c2C)cc1F |
| InChI | InChI=1S/C12H14FN3O3S/c1-3-19-11-5-4-9(6-10(11)13)16-20(17,18)12-7-14-15-8(12)2/h4-7,16H,3H2,1-2H3,(H,14,15) |
| InChIKey | LBSVNQFYDIUAPE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |