C19H24ClN7O4 — CID 11562155
3-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]propanoic acid (PubChem CID 11562155) has the molecular formula C19H24ClN7O4 and a molecular weight of 449.90 g/mol. Its IUPAC name is 3-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]propanoic acid.
| Compound Name | 3-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 11562155 |
| Molecular Formula | C19H24ClN7O4 |
| Molecular Weight | 449.90 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 3-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]propanoic acid |
| SMILES | N/C(=N\CCCCc1ccc(OCCC(=O)O)cc1)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C19H24ClN7O4/c20-15-17(22)26-16(21)14(25-15)18(30)27-19(23)24-9-2-1-3-11-4-6-12(7-5-11)31-10-8-13(28)29/h4-7H,1-3,8-10H2,(H,28,29)(H4,21,22,26)(H3,23,24,27,30) |
| InChIKey | OBEIEHDVAGSDIV-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 191.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.90 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|