C23H26F2N6O2S — CID 11562200
2-(1,1-difluoroethyl)-7-[3-[[4-methyl-5-(4-methyl-1,3-oxazol-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-5,6,8,9-tetrahydro-[1,3]oxazolo[4,5-h][3]benzazepine (PubChem CID 11562200) has the molecular formula C23H26F2N6O2S and a molecular weight of 488.56 g/mol. Its IUPAC name is 2-(1,1-difluoroethyl)-7-[3-[[4-methyl-5-(4-methyl-1,3-oxazol-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-5,6,8,9-tetrahydro-[1,3]oxazolo[4,5-h][3]benzazepine.
| Compound Name | 2-(1,1-difluoroethyl)-7-[3-[[4-methyl-5-(4-methyl-1,3-oxazol-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-5,6,8,9-tetrahydro-[1,3]oxazolo[4,5-h][3]benzazepine |
|---|---|
| PubChem CID | 11562200 |
| Molecular Formula | C23H26F2N6O2S |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | 2-(1,1-difluoroethyl)-7-[3-[[4-methyl-5-(4-methyl-1,3-oxazol-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-5,6,8,9-tetrahydro-[1,3]oxazolo[4,5-h][3]benzazepine |
| SMILES | Cc1ncoc1-c1nnc(SCCCN2CCc3cc4nc(C(C)(F)F)oc4cc3CC2)n1C |
| InChI | InChI=1S/C23H26F2N6O2S/c1-14-19(32-13-26-14)20-28-29-22(30(20)3)34-10-4-7-31-8-5-15-11-17-18(12-16(15)6-9-31)33-21(27-17)23(2,24)25/h11-13H,4-10H2,1-3H3 |
| InChIKey | KGDPFNITOFAOLP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 86.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|