C13H21BrN2 — CID 115622616
N-[(5-bromo-2-pyridinyl)methyl]-N,4-dimethylpentan-2-amine (PubChem CID 115622616) has the molecular formula C13H21BrN2 and a molecular weight of 285.23 g/mol. Its IUPAC name is N-[(5-bromo-2-pyridinyl)methyl]-N,4-dimethylpentan-2-amine.
| Compound Name | N-[(5-bromo-2-pyridinyl)methyl]-N,4-dimethylpentan-2-amine |
|---|---|
| PubChem CID | 115622616 |
| Molecular Formula | C13H21BrN2 |
| Molecular Weight | 285.23 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | N-[(5-bromo-2-pyridinyl)methyl]-N,4-dimethylpentan-2-amine |
| SMILES | CC(C)CC(C)N(C)Cc1ccc(Br)cn1 |
| InChI | InChI=1S/C13H21BrN2/c1-10(2)7-11(3)16(4)9-13-6-5-12(14)8-15-13/h5-6,8,10-11H,7,9H2,1-4H3 |
| InChIKey | UVIVJISHLVNAMJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.23 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |