C11H21N3O — CID 115623040
2-methyl-1-[(1-propan-2-ylpyrazol-4-yl)methylamino]propan-2-ol (PubChem CID 115623040) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 2-methyl-1-[(1-propan-2-ylpyrazol-4-yl)methylamino]propan-2-ol.
| Compound Name | 2-methyl-1-[(1-propan-2-ylpyrazol-4-yl)methylamino]propan-2-ol |
|---|---|
| PubChem CID | 115623040 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 2-methyl-1-[(1-propan-2-ylpyrazol-4-yl)methylamino]propan-2-ol |
| SMILES | CC(C)n1cc(CNCC(C)(C)O)cn1 |
| InChI | InChI=1S/C11H21N3O/c1-9(2)14-7-10(6-13-14)5-12-8-11(3,4)15/h6-7,9,12,15H,5,8H2,1-4H3 |
| InChIKey | NCJLTGZMBUPFAW-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |