C17H19F2N — CID 115623663
N-[(3,5-difluorophenyl)methyl]-4-phenylbutan-2-amine (PubChem CID 115623663) has the molecular formula C17H19F2N and a molecular weight of 275.34 g/mol. Its IUPAC name is N-[(3,5-difluorophenyl)methyl]-4-phenylbutan-2-amine.
| Compound Name | N-[(3,5-difluorophenyl)methyl]-4-phenylbutan-2-amine |
|---|---|
| PubChem CID | 115623663 |
| Molecular Formula | C17H19F2N |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | N-[(3,5-difluorophenyl)methyl]-4-phenylbutan-2-amine |
| SMILES | CC(CCc1ccccc1)NCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C17H19F2N/c1-13(7-8-14-5-3-2-4-6-14)20-12-15-9-16(18)11-17(19)10-15/h2-6,9-11,13,20H,7-8,12H2,1H3 |
| InChIKey | AOMZFJZCKRJSQX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |