C12H24N4O3 — CID 115623786
2-[(4-ethylmorpholin-2-yl)methylamino]-N-(methylcarbamoyl)propanamide (PubChem CID 115623786) has the molecular formula C12H24N4O3 and a molecular weight of 272.35 g/mol. Its IUPAC name is 2-[(4-ethylmorpholin-2-yl)methylamino]-N-(methylcarbamoyl)propanamide.
| Compound Name | 2-[(4-ethylmorpholin-2-yl)methylamino]-N-(methylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 115623786 |
| Molecular Formula | C12H24N4O3 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 2-[(4-ethylmorpholin-2-yl)methylamino]-N-(methylcarbamoyl)propanamide |
| SMILES | CCN1CCOC(CNC(C)C(=O)NC(=O)NC)C1 |
| InChI | InChI=1S/C12H24N4O3/c1-4-16-5-6-19-10(8-16)7-14-9(2)11(17)15-12(18)13-3/h9-10,14H,4-8H2,1-3H3,(H2,13,15,17,18) |
| InChIKey | WHIPBDRXJJOBLM-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |