About 2-(benzenesulfinyl)ethylsulfinylbenzene;palladium(2+);diacetate
2-(benzenesulfinyl)ethylsulfinylbenzene;palladium(2+);diacetate (PubChem CID 11562441) has the molecular formula C18H20O6PdS2
and a molecular weight of 502.91 g/mol. Its IUPAC name is 2-(benzenesulfinyl)ethylsulfinylbenzene;palladium(2+);diacetate.
Molecular Properties
| Compound Name | 2-(benzenesulfinyl)ethylsulfinylbenzene;palladium(2+);diacetate |
| PubChem CID | 11562441 |
| Molecular Formula | C18H20O6PdS2 |
| Molecular Weight | 502.91 g/mol |
| Exact Mass | 501.97 |
| IUPAC Name | 2-(benzenesulfinyl)ethylsulfinylbenzene;palladium(2+);diacetate |
| SMILES | CC(=O)[O-].CC(=O)[O-].O=S(CCS(=O)c1ccccc1)c1ccccc1.[Pd+2] |
| InChI | InChI=1S/C14H14O2S2.2C2H4O2.Pd/c15-17(13-7-3-1-4-8-13)11-12-18(16)14-9-5-2-6-10-14;2*1-2(3)4;/h1-10H,11-12H2;2*1H3,(H,3,4);/q;;;+2/p-2 |
| InChIKey | SNNYSJNYZJXIFE-UHFFFAOYSA-L |
| XLogP | 0.11 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 502.91 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(benzenesulfinyl)ethylsulfinylbenzene;palladium(2+);diacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzenesulfinyl)ethylsulfinylbenzene;palladium(2+);diacetate?
The IUPAC name of 2-(benzenesulfinyl)ethylsulfinylbenzene;palladium(2+);diacetate (CID 11562441) is 2-(benzenesulfinyl)ethylsulfinylbenzene;palladium(2+);diacetate.
What is the SMILES notation for 2-(benzenesulfinyl)ethylsulfinylbenzene;palladium(2+);diacetate?
The canonical SMILES for 2-(benzenesulfinyl)ethylsulfinylbenzene;palladium(2+);diacetate is CC(=O)[O-].CC(=O)[O-].O=S(CCS(=O)c1ccccc1)c1ccccc1.[Pd+2].
What is the InChIKey of 2-(benzenesulfinyl)ethylsulfinylbenzene;palladium(2+);diacetate?
The InChIKey is SNNYSJNYZJXIFE-UHFFFAOYSA-L. The full InChI is InChI=1S/C14H14O2S2.2C2H4O2.Pd/c15-17(13-7-3-1-4-8-13)11-12-18(16)14-9-5-2-6-10-14;2*1-2(3)4;/h1-10H,11-12H2;2*1H3,(H,3,4);/q;;;+2/p-2.
What are the key properties of 2-(benzenesulfinyl)ethylsulfinylbenzene;palladium(2+);diacetate?
2-(benzenesulfinyl)ethylsulfinylbenzene;palladium(2+);diacetate has a molecular weight of 502.91 g/mol, XLogP of 0.11, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzenesulfinyl)ethylsulfinylbenzene;palladium(2+);diacetate is sourced from PubChem (CID 11562441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).