C29H36N4O4 — CID 11562461
N-[1-(cyanomethylcarbamoyl)cyclohexyl]-4-[4-[1-(2-hydroxyethyl)piperidin-4-yl]oxyphenyl]benzamide (PubChem CID 11562461) has the molecular formula C29H36N4O4 and a molecular weight of 504.63 g/mol. Its IUPAC name is N-[1-(cyanomethylcarbamoyl)cyclohexyl]-4-[4-[1-(2-hydroxyethyl)piperidin-4-yl]oxyphenyl]benzamide.
| Compound Name | N-[1-(cyanomethylcarbamoyl)cyclohexyl]-4-[4-[1-(2-hydroxyethyl)piperidin-4-yl]oxyphenyl]benzamide |
|---|---|
| PubChem CID | 11562461 |
| Molecular Formula | C29H36N4O4 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | N-[1-(cyanomethylcarbamoyl)cyclohexyl]-4-[4-[1-(2-hydroxyethyl)piperidin-4-yl]oxyphenyl]benzamide |
| SMILES | N#CCNC(=O)C1(NC(=O)c2ccc(-c3ccc(OC4CCN(CCO)CC4)cc3)cc2)CCCCC1 |
| InChI | InChI=1S/C29H36N4O4/c30-16-17-31-28(36)29(14-2-1-3-15-29)32-27(35)24-6-4-22(5-7-24)23-8-10-25(11-9-23)37-26-12-18-33(19-13-26)20-21-34/h4-11,26,34H,1-3,12-15,17-21H2,(H,31,36)(H,32,35) |
| InChIKey | ARUOKGIJLBMXHU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|