C21H16INO6 — CID 11562467
(E)-3-([1,3]dioxolo[4,5-g]quinolin-8-yl)-2-(2-iodo-4,5-dimethoxyphenyl)prop-2-enoic acid (PubChem CID 11562467) has the molecular formula C21H16INO6 and a molecular weight of 505.26 g/mol. Its IUPAC name is (E)-3-([1,3]dioxolo[4,5-g]quinolin-8-yl)-2-(2-iodo-4,5-dimethoxyphenyl)prop-2-enoic acid.
| Compound Name | (E)-3-([1,3]dioxolo[4,5-g]quinolin-8-yl)-2-(2-iodo-4,5-dimethoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 11562467 |
| Molecular Formula | C21H16INO6 |
| Molecular Weight | 505.26 g/mol |
| Exact Mass | 505.00 |
| IUPAC Name | (E)-3-([1,3]dioxolo[4,5-g]quinolin-8-yl)-2-(2-iodo-4,5-dimethoxyphenyl)prop-2-enoic acid |
| SMILES | COc1cc(I)c(/C(=C\c2ccnc3cc4c(cc23)OCO4)C(=O)O)cc1OC |
| InChI | InChI=1S/C21H16INO6/c1-26-17-7-13(15(22)8-18(17)27-2)14(21(24)25)5-11-3-4-23-16-9-20-19(6-12(11)16)28-10-29-20/h3-9H,10H2,1-2H3,(H,24,25)/b14-5+ |
| InChIKey | DGUFPWUSKKJMTA-LHHJGKSTSA-N |
| XLogP | 4.21 |
| TPSA | 87.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.26 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|