C12H18N2S — CID 115625870
N-(pyridin-2-ylmethyl)-1-(thian-4-yl)methanamine (PubChem CID 115625870) has the molecular formula C12H18N2S and a molecular weight of 222.36 g/mol. Its IUPAC name is N-(pyridin-2-ylmethyl)-1-(thian-4-yl)methanamine.
| Compound Name | N-(pyridin-2-ylmethyl)-1-(thian-4-yl)methanamine |
|---|---|
| PubChem CID | 115625870 |
| Molecular Formula | C12H18N2S |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | N-(pyridin-2-ylmethyl)-1-(thian-4-yl)methanamine |
| SMILES | c1ccc(CNCC2CCSCC2)nc1 |
| InChI | InChI=1S/C12H18N2S/c1-2-6-14-12(3-1)10-13-9-11-4-7-15-8-5-11/h1-3,6,11,13H,4-5,7-10H2 |
| InChIKey | SBZBTONHDNTWNO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |