C14H19N3O — CID 115626675
4-methoxy-N-methyl-1-quinoxalin-6-ylbutan-1-amine (PubChem CID 115626675) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 4-methoxy-N-methyl-1-quinoxalin-6-ylbutan-1-amine.
| Compound Name | 4-methoxy-N-methyl-1-quinoxalin-6-ylbutan-1-amine |
|---|---|
| PubChem CID | 115626675 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 4-methoxy-N-methyl-1-quinoxalin-6-ylbutan-1-amine |
| SMILES | CNC(CCCOC)c1ccc2nccnc2c1 |
| InChI | InChI=1S/C14H19N3O/c1-15-12(4-3-9-18-2)11-5-6-13-14(10-11)17-8-7-16-13/h5-8,10,12,15H,3-4,9H2,1-2H3 |
| InChIKey | PWUZHVPYFCSKOX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|