C11H13FN2O4S — CID 115627360
N-(2-ethylsulfinylethyl)-3-fluoro-4-nitrobenzamide (PubChem CID 115627360) has the molecular formula C11H13FN2O4S and a molecular weight of 288.30 g/mol. Its IUPAC name is N-(2-ethylsulfinylethyl)-3-fluoro-4-nitrobenzamide.
| Compound Name | N-(2-ethylsulfinylethyl)-3-fluoro-4-nitrobenzamide |
|---|---|
| PubChem CID | 115627360 |
| Molecular Formula | C11H13FN2O4S |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | N-(2-ethylsulfinylethyl)-3-fluoro-4-nitrobenzamide |
| SMILES | CCS(=O)CCNC(=O)c1ccc([N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C11H13FN2O4S/c1-2-19(18)6-5-13-11(15)8-3-4-10(14(16)17)9(12)7-8/h3-4,7H,2,5-6H2,1H3,(H,13,15) |
| InChIKey | UWPZGQKVOGSWHG-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|