C12H26N2O — CID 115627468
N-tert-butyl-2-(3,3-dimethylbutan-2-ylamino)acetamide (PubChem CID 115627468) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is N-tert-butyl-2-(3,3-dimethylbutan-2-ylamino)acetamide.
| Compound Name | N-tert-butyl-2-(3,3-dimethylbutan-2-ylamino)acetamide |
|---|---|
| PubChem CID | 115627468 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | N-tert-butyl-2-(3,3-dimethylbutan-2-ylamino)acetamide |
| SMILES | CC(NCC(=O)NC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H26N2O/c1-9(11(2,3)4)13-8-10(15)14-12(5,6)7/h9,13H,8H2,1-7H3,(H,14,15) |
| InChIKey | YBJSCGCDXPAOGE-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |