About 1-N,1-N-dimethyl-4-N-[(E)-pent-3-enyl]piperidine-1,4-dicarboxamide
1-N,1-N-dimethyl-4-N-[(E)-pent-3-enyl]piperidine-1,4-dicarboxamide (PubChem CID 115627671) has the molecular formula C14H25N3O2
and a molecular weight of 267.37 g/mol. Its IUPAC name is 1-N,1-N-dimethyl-4-N-[(E)-pent-3-enyl]piperidine-1,4-dicarboxamide.
Molecular Properties
| Compound Name | 1-N,1-N-dimethyl-4-N-[(E)-pent-3-enyl]piperidine-1,4-dicarboxamide |
| PubChem CID | 115627671 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | 1-N,1-N-dimethyl-4-N-[(E)-pent-3-enyl]piperidine-1,4-dicarboxamide |
| SMILES | C/C=C/CCNC(=O)C1CCN(C(=O)N(C)C)CC1 |
| InChI | InChI=1S/C14H25N3O2/c1-4-5-6-9-15-13(18)12-7-10-17(11-8-12)14(19)16(2)3/h4-5,12H,6-11H2,1-3H3,(H,15,18)/b5-4+ |
| InChIKey | SVDWGQMNNIZRDO-SNAWJCMRSA-N |
| XLogP | 1.46 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-N,1-N-dimethyl-4-N-[(E)-pent-3-enyl]piperidine-1,4-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,1-N-dimethyl-4-N-[(E)-pent-3-enyl]piperidine-1,4-dicarboxamide?
The IUPAC name of 1-N,1-N-dimethyl-4-N-[(E)-pent-3-enyl]piperidine-1,4-dicarboxamide (CID 115627671) is 1-N,1-N-dimethyl-4-N-[(E)-pent-3-enyl]piperidine-1,4-dicarboxamide.
What is the SMILES notation for 1-N,1-N-dimethyl-4-N-[(E)-pent-3-enyl]piperidine-1,4-dicarboxamide?
The canonical SMILES for 1-N,1-N-dimethyl-4-N-[(E)-pent-3-enyl]piperidine-1,4-dicarboxamide is C/C=C/CCNC(=O)C1CCN(C(=O)N(C)C)CC1.
What is the InChIKey of 1-N,1-N-dimethyl-4-N-[(E)-pent-3-enyl]piperidine-1,4-dicarboxamide?
The InChIKey is SVDWGQMNNIZRDO-SNAWJCMRSA-N. The full InChI is InChI=1S/C14H25N3O2/c1-4-5-6-9-15-13(18)12-7-10-17(11-8-12)14(19)16(2)3/h4-5,12H,6-11H2,1-3H3,(H,15,18)/b5-4+.
What are the key properties of 1-N,1-N-dimethyl-4-N-[(E)-pent-3-enyl]piperidine-1,4-dicarboxamide?
1-N,1-N-dimethyl-4-N-[(E)-pent-3-enyl]piperidine-1,4-dicarboxamide has a molecular weight of 267.37 g/mol, XLogP of 1.46, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,1-N-dimethyl-4-N-[(E)-pent-3-enyl]piperidine-1,4-dicarboxamide is sourced from PubChem (CID 115627671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).