C10H12BrNOS — CID 115627914
5-bromo-N-[(E)-pent-3-enyl]thiophene-2-carboxamide (PubChem CID 115627914) has the molecular formula C10H12BrNOS and a molecular weight of 274.18 g/mol. Its IUPAC name is 5-bromo-N-[(E)-pent-3-enyl]thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-[(E)-pent-3-enyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 115627914 |
| Molecular Formula | C10H12BrNOS |
| Molecular Weight | 274.18 g/mol |
| Exact Mass | 272.98 |
| IUPAC Name | 5-bromo-N-[(E)-pent-3-enyl]thiophene-2-carboxamide |
| SMILES | C/C=C/CCNC(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C10H12BrNOS/c1-2-3-4-7-12-10(13)8-5-6-9(11)14-8/h2-3,5-6H,4,7H2,1H3,(H,12,13)/b3-2+ |
| InChIKey | DCYIIQJDLBEWSO-NSCUHMNNSA-N |
| XLogP | 3.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.18 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|