C10H15N3O — CID 115628402
1-methyl-N-[(E)-pent-3-enyl]pyrazole-4-carboxamide (PubChem CID 115628402) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 1-methyl-N-[(E)-pent-3-enyl]pyrazole-4-carboxamide.
| Compound Name | 1-methyl-N-[(E)-pent-3-enyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 115628402 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 1-methyl-N-[(E)-pent-3-enyl]pyrazole-4-carboxamide |
| SMILES | C/C=C/CCNC(=O)c1cnn(C)c1 |
| InChI | InChI=1S/C10H15N3O/c1-3-4-5-6-11-10(14)9-7-12-13(2)8-9/h3-4,7-8H,5-6H2,1-2H3,(H,11,14)/b4-3+ |
| InChIKey | HBTGFIBGYLPZTN-ONEGZZNKSA-N |
| XLogP | 1.12 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|