About N-[(E)-pent-3-enyl]-2-(2,2,2-trifluoroethylamino)acetamide
N-[(E)-pent-3-enyl]-2-(2,2,2-trifluoroethylamino)acetamide (PubChem CID 115628435) has the molecular formula C9H15F3N2O
and a molecular weight of 224.23 g/mol. Its IUPAC name is N-[(E)-pent-3-enyl]-2-(2,2,2-trifluoroethylamino)acetamide.
Molecular Properties
| Compound Name | N-[(E)-pent-3-enyl]-2-(2,2,2-trifluoroethylamino)acetamide |
| PubChem CID | 115628435 |
| Molecular Formula | C9H15F3N2O |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | N-[(E)-pent-3-enyl]-2-(2,2,2-trifluoroethylamino)acetamide |
| SMILES | C/C=C/CCNC(=O)CNCC(F)(F)F |
| InChI | InChI=1S/C9H15F3N2O/c1-2-3-4-5-14-8(15)6-13-7-9(10,11)12/h2-3,13H,4-7H2,1H3,(H,14,15)/b3-2+ |
| InChIKey | XJAAXWJSSNHAFR-NSCUHMNNSA-N |
| XLogP | 1.22 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-pent-3-enyl]-2-(2,2,2-trifluoroethylamino)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-pent-3-enyl]-2-(2,2,2-trifluoroethylamino)acetamide?
The IUPAC name of N-[(E)-pent-3-enyl]-2-(2,2,2-trifluoroethylamino)acetamide (CID 115628435) is N-[(E)-pent-3-enyl]-2-(2,2,2-trifluoroethylamino)acetamide.
What is the SMILES notation for N-[(E)-pent-3-enyl]-2-(2,2,2-trifluoroethylamino)acetamide?
The canonical SMILES for N-[(E)-pent-3-enyl]-2-(2,2,2-trifluoroethylamino)acetamide is C/C=C/CCNC(=O)CNCC(F)(F)F.
What is the InChIKey of N-[(E)-pent-3-enyl]-2-(2,2,2-trifluoroethylamino)acetamide?
The InChIKey is XJAAXWJSSNHAFR-NSCUHMNNSA-N. The full InChI is InChI=1S/C9H15F3N2O/c1-2-3-4-5-14-8(15)6-13-7-9(10,11)12/h2-3,13H,4-7H2,1H3,(H,14,15)/b3-2+.
What are the key properties of N-[(E)-pent-3-enyl]-2-(2,2,2-trifluoroethylamino)acetamide?
N-[(E)-pent-3-enyl]-2-(2,2,2-trifluoroethylamino)acetamide has a molecular weight of 224.23 g/mol, XLogP of 1.22, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-pent-3-enyl]-2-(2,2,2-trifluoroethylamino)acetamide is sourced from PubChem (CID 115628435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).