About 2,2,2-trifluoroethyl N-[(E)-pent-3-enyl]carbamate
2,2,2-trifluoroethyl N-[(E)-pent-3-enyl]carbamate (PubChem CID 115629223) has the molecular formula C8H12F3NO2
and a molecular weight of 211.18 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[(E)-pent-3-enyl]carbamate.
Molecular Properties
| Compound Name | 2,2,2-trifluoroethyl N-[(E)-pent-3-enyl]carbamate |
| PubChem CID | 115629223 |
| Molecular Formula | C8H12F3NO2 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[(E)-pent-3-enyl]carbamate |
| SMILES | C/C=C/CCNC(=O)OCC(F)(F)F |
| InChI | InChI=1S/C8H12F3NO2/c1-2-3-4-5-12-7(13)14-6-8(9,10)11/h2-3H,4-6H2,1H3,(H,12,13)/b3-2+ |
| InChIKey | CHACFQPIWRHWDK-NSCUHMNNSA-N |
| XLogP | 2.24 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,2,2-trifluoroethyl N-[(E)-pent-3-enyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoroethyl N-[(E)-pent-3-enyl]carbamate?
The IUPAC name of 2,2,2-trifluoroethyl N-[(E)-pent-3-enyl]carbamate (CID 115629223) is 2,2,2-trifluoroethyl N-[(E)-pent-3-enyl]carbamate.
What is the SMILES notation for 2,2,2-trifluoroethyl N-[(E)-pent-3-enyl]carbamate?
The canonical SMILES for 2,2,2-trifluoroethyl N-[(E)-pent-3-enyl]carbamate is C/C=C/CCNC(=O)OCC(F)(F)F.
What is the InChIKey of 2,2,2-trifluoroethyl N-[(E)-pent-3-enyl]carbamate?
The InChIKey is CHACFQPIWRHWDK-NSCUHMNNSA-N. The full InChI is InChI=1S/C8H12F3NO2/c1-2-3-4-5-12-7(13)14-6-8(9,10)11/h2-3H,4-6H2,1H3,(H,12,13)/b3-2+.
What are the key properties of 2,2,2-trifluoroethyl N-[(E)-pent-3-enyl]carbamate?
2,2,2-trifluoroethyl N-[(E)-pent-3-enyl]carbamate has a molecular weight of 211.18 g/mol, XLogP of 2.24, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoroethyl N-[(E)-pent-3-enyl]carbamate is sourced from PubChem (CID 115629223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).