C31H33F3O3S — CID 11562931
4-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-[[4-(trifluoromethylsulfanyl)phenyl]methoxy]methyl]benzoic acid (PubChem CID 11562931) has the molecular formula C31H33F3O3S and a molecular weight of 542.66 g/mol. Its IUPAC name is 4-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-[[4-(trifluoromethylsulfanyl)phenyl]methoxy]methyl]benzoic acid.
| Compound Name | 4-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-[[4-(trifluoromethylsulfanyl)phenyl]methoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 11562931 |
| Molecular Formula | C31H33F3O3S |
| Molecular Weight | 542.66 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | 4-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-[[4-(trifluoromethylsulfanyl)phenyl]methoxy]methyl]benzoic acid |
| SMILES | Cc1cc2c(cc1C(OCc1ccc(SC(F)(F)F)cc1)c1ccc(C(=O)O)cc1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C31H33F3O3S/c1-19-16-25-26(30(4,5)15-14-29(25,2)3)17-24(19)27(21-8-10-22(11-9-21)28(35)36)37-18-20-6-12-23(13-7-20)38-31(32,33)34/h6-13,16-17,27H,14-15,18H2,1-5H3,(H,35,36) |
| InChIKey | KSBADTDMSYIHGK-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.66 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |