C14H23NO4 — CID 115629672
2-[2-hydroxyethyl(2-methoxyethyl)amino]-1-(3-methoxyphenyl)ethanol (PubChem CID 115629672) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is 2-[2-hydroxyethyl(2-methoxyethyl)amino]-1-(3-methoxyphenyl)ethanol.
| Compound Name | 2-[2-hydroxyethyl(2-methoxyethyl)amino]-1-(3-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 115629672 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 2-[2-hydroxyethyl(2-methoxyethyl)amino]-1-(3-methoxyphenyl)ethanol |
| SMILES | COCCN(CCO)CC(O)c1cccc(OC)c1 |
| InChI | InChI=1S/C14H23NO4/c1-18-9-7-15(6-8-16)11-14(17)12-4-3-5-13(10-12)19-2/h3-5,10,14,16-17H,6-9,11H2,1-2H3 |
| InChIKey | BTLINSALOYIGGV-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |