C15H23BrN2 — CID 115630376
3-bromo-5-[(4-tert-butylpiperidin-1-yl)methyl]pyridine (PubChem CID 115630376) has the molecular formula C15H23BrN2 and a molecular weight of 311.27 g/mol. Its IUPAC name is 3-bromo-5-[(4-tert-butylpiperidin-1-yl)methyl]pyridine.
| Compound Name | 3-bromo-5-[(4-tert-butylpiperidin-1-yl)methyl]pyridine |
|---|---|
| PubChem CID | 115630376 |
| Molecular Formula | C15H23BrN2 |
| Molecular Weight | 311.27 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 3-bromo-5-[(4-tert-butylpiperidin-1-yl)methyl]pyridine |
| SMILES | CC(C)(C)C1CCN(Cc2cncc(Br)c2)CC1 |
| InChI | InChI=1S/C15H23BrN2/c1-15(2,3)13-4-6-18(7-5-13)11-12-8-14(16)10-17-9-12/h8-10,13H,4-7,11H2,1-3H3 |
| InChIKey | JVJKMZRTQKBTOY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.27 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |